About 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid
7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid (PubChem CID 87567198) has the molecular formula C18H28N2O4
and a molecular weight of 336.43 g/mol. Its IUPAC name is 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid.
Molecular Properties
| Compound Name | 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid |
| PubChem CID | 87567198 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid |
| SMILES | NC(CCCCCC(=O)O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C18H28N2O4/c19-15(4-2-1-3-5-18(23)24)14-8-6-13(7-9-14)12-20-16(21)10-11-17(20)22/h10-11,13-15H,1-9,12,19H2,(H,23,24) |
| InChIKey | ZAHMCDOFCKXRSH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid?
The IUPAC name of 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid (CID 87567198) is 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid.
What is the SMILES notation for 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid?
The canonical SMILES for 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid is NC(CCCCCC(=O)O)C1CCC(CN2C(=O)C=CC2=O)CC1.
What is the InChIKey of 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid?
The InChIKey is ZAHMCDOFCKXRSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O4/c19-15(4-2-1-3-5-18(23)24)14-8-6-13(7-9-14)12-20-16(21)10-11-17(20)22/h10-11,13-15H,1-9,12,19H2,(H,23,24).
What are the key properties of 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid?
7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid has a molecular weight of 336.43 g/mol, XLogP of 2.08, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-7-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]heptanoic acid is sourced from PubChem (CID 87567198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).