About iron;1,1,2-trichloroethene
iron;1,1,2-trichloroethene (PubChem CID 87567250) has the molecular formula C2HCl3Fe
and a molecular weight of 187.23 g/mol. Its IUPAC name is iron;1,1,2-trichloroethene.
Molecular Properties
| Compound Name | iron;1,1,2-trichloroethene |
| PubChem CID | 87567250 |
| Molecular Formula | C2HCl3Fe |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 185.85 |
| IUPAC Name | iron;1,1,2-trichloroethene |
| SMILES | ClC=C(Cl)Cl.[Fe] |
| InChI | InChI=1S/C2HCl3.Fe/c3-1-2(4)5;/h1H; |
| InChIKey | LLHITCBVCUPTBV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;1,1,2-trichloroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;1,1,2-trichloroethene?
The IUPAC name of iron;1,1,2-trichloroethene (CID 87567250) is iron;1,1,2-trichloroethene.
What is the SMILES notation for iron;1,1,2-trichloroethene?
The canonical SMILES for iron;1,1,2-trichloroethene is ClC=C(Cl)Cl.[Fe].
What is the InChIKey of iron;1,1,2-trichloroethene?
The InChIKey is LLHITCBVCUPTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HCl3.Fe/c3-1-2(4)5;/h1H;.
What are the key properties of iron;1,1,2-trichloroethene?
iron;1,1,2-trichloroethene has a molecular weight of 187.23 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iron;1,1,2-trichloroethene is sourced from PubChem (CID 87567250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).