C18H31NO2 — CID 87567624
1-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)dodecane-1,3-dione (PubChem CID 87567624) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)dodecane-1,3-dione.
| Compound Name | 1-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)dodecane-1,3-dione |
|---|---|
| PubChem CID | 87567624 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 1-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)dodecane-1,3-dione |
| SMILES | CCCCCCCCCC(=O)CC(=O)N1C(C)C=CC1C |
| InChI | InChI=1S/C18H31NO2/c1-4-5-6-7-8-9-10-11-17(20)14-18(21)19-15(2)12-13-16(19)3/h12-13,15-16H,4-11,14H2,1-3H3 |
| InChIKey | IJXNIABSYPTTFD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|