About 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium
1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium (PubChem CID 87568440) has the molecular formula C29H32O2S
and a molecular weight of 444.64 g/mol. Its IUPAC name is 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium.
Molecular Properties
| Compound Name | 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium |
| PubChem CID | 87568440 |
| Molecular Formula | C29H32O2S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium |
| SMILES | CC1(C)C2CCC1(C)C(C(=O)[O-])C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C11H18O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10(2)7-4-5-11(10,3)8(6-7)9(12)13/h1-15H;7-8H,4-6H2,1-3H3,(H,12,13)/q+1;/p-1 |
| InChIKey | AYOVOOFUMROFAS-UHFFFAOYSA-M |
| XLogP | 5.98 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
The IUPAC name of 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium (CID 87568440) is 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium.
What is the SMILES notation for 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
The canonical SMILES for 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium is CC1(C)C2CCC1(C)C(C(=O)[O-])C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
The InChIKey is AYOVOOFUMROFAS-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C11H18O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10(2)7-4-5-11(10,3)8(6-7)9(12)13/h1-15H;7-8H,4-6H2,1-3H3,(H,12,13)/q+1;/p-1.
What are the key properties of 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium has a molecular weight of 444.64 g/mol, XLogP of 5.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7,7-trimethylbicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium is sourced from PubChem (CID 87568440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).