C10H10N4S2 — CID 87568576
4-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylmethyl)-1,3-dihydroimidazole-2-thione (PubChem CID 87568576) has the molecular formula C10H10N4S2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylmethyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylmethyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 87568576 |
| Molecular Formula | C10H10N4S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 4-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylmethyl)-1,3-dihydroimidazole-2-thione |
| SMILES | S=c1[nH]cc(CC2=CC=CN3SNC=C23)[nH]1 |
| InChI | InChI=1S/C10H10N4S2/c15-10-11-5-8(13-10)4-7-2-1-3-14-9(7)6-12-16-14/h1-3,5-6,12H,4H2,(H2,11,13,15) |
| InChIKey | QRXAAUYURKHQEU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|