About 1-methyl-1-nitrosourea;nitrous amide
1-methyl-1-nitrosourea;nitrous amide (PubChem CID 87568751) has the molecular formula C2H7N5O3
and a molecular weight of 149.11 g/mol. Its IUPAC name is 1-methyl-1-nitrosourea;nitrous amide.
Molecular Properties
| Compound Name | 1-methyl-1-nitrosourea;nitrous amide |
| PubChem CID | 87568751 |
| Molecular Formula | C2H7N5O3 |
| Molecular Weight | 149.11 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 1-methyl-1-nitrosourea;nitrous amide |
| SMILES | CN(N=O)C(N)=O.NN=O |
| InChI | InChI=1S/C2H5N3O2.H2N2O/c1-5(4-7)2(3)6;1-2-3/h1H3,(H2,3,6);(H2,1,3) |
| InChIKey | CXTBJFADFGNFBB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-nitrosourea;nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-nitrosourea;nitrous amide?
The IUPAC name of 1-methyl-1-nitrosourea;nitrous amide (CID 87568751) is 1-methyl-1-nitrosourea;nitrous amide.
What is the SMILES notation for 1-methyl-1-nitrosourea;nitrous amide?
The canonical SMILES for 1-methyl-1-nitrosourea;nitrous amide is CN(N=O)C(N)=O.NN=O.
What is the InChIKey of 1-methyl-1-nitrosourea;nitrous amide?
The InChIKey is CXTBJFADFGNFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2.H2N2O/c1-5(4-7)2(3)6;1-2-3/h1H3,(H2,3,6);(H2,1,3).
What are the key properties of 1-methyl-1-nitrosourea;nitrous amide?
1-methyl-1-nitrosourea;nitrous amide has a molecular weight of 149.11 g/mol, XLogP of -0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-nitrosourea;nitrous amide is sourced from PubChem (CID 87568751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).