C19H26O7S — CID 87568754
2-[(1R,2S)-5-(1,3-dioxolan-2-yl)-2-phenylmethoxycarbonylcyclohexyl]ethanesulfonic acid (PubChem CID 87568754) has the molecular formula C19H26O7S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[(1R,2S)-5-(1,3-dioxolan-2-yl)-2-phenylmethoxycarbonylcyclohexyl]ethanesulfonic acid.
| Compound Name | 2-[(1R,2S)-5-(1,3-dioxolan-2-yl)-2-phenylmethoxycarbonylcyclohexyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 87568754 |
| Molecular Formula | C19H26O7S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[(1R,2S)-5-(1,3-dioxolan-2-yl)-2-phenylmethoxycarbonylcyclohexyl]ethanesulfonic acid |
| SMILES | O=C(OCc1ccccc1)[C@H]1CCC(C2OCCO2)C[C@@H]1CCS(=O)(=O)O |
| InChI | InChI=1S/C19H26O7S/c20-18(26-13-14-4-2-1-3-5-14)17-7-6-16(19-24-9-10-25-19)12-15(17)8-11-27(21,22)23/h1-5,15-17,19H,6-13H2,(H,21,22,23)/t15-,16?,17-/m0/s1 |
| InChIKey | LCXLUTXKPVIHTC-QRFGZVGRSA-N |
| XLogP | 2.41 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|