About N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride
N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride (PubChem CID 87568764) has the molecular formula C5H5ClN4O
and a molecular weight of 172.58 g/mol. Its IUPAC name is N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride.
Molecular Properties
| Compound Name | N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride |
| PubChem CID | 87568764 |
| Molecular Formula | C5H5ClN4O |
| Molecular Weight | 172.58 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride |
| SMILES | CN(C(=O)Cl)c1ncncn1 |
| InChI | InChI=1S/C5H5ClN4O/c1-10(4(6)11)5-8-2-7-3-9-5/h2-3H,1H3 |
| InChIKey | QAPXYDWKDLAOOV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.58 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride?
The IUPAC name of N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride (CID 87568764) is N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride.
What is the SMILES notation for N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride?
The canonical SMILES for N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride is CN(C(=O)Cl)c1ncncn1.
What is the InChIKey of N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride?
The InChIKey is QAPXYDWKDLAOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN4O/c1-10(4(6)11)5-8-2-7-3-9-5/h2-3H,1H3.
What are the key properties of N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride?
N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride has a molecular weight of 172.58 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(1,3,5-triazin-2-yl)carbamoyl chloride is sourced from PubChem (CID 87568764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).