About bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate
bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate (PubChem CID 87568855) has the molecular formula C14H16BF4-
and a molecular weight of 271.09 g/mol. Its IUPAC name is bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate.
Molecular Properties
| Compound Name | bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate |
| PubChem CID | 87568855 |
| Molecular Formula | C14H16BF4- |
| Molecular Weight | 271.09 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate |
| SMILES | C1=C2CCC(=C1)C2.C1=C2CCC(=C1)C2.F[B-](F)(F)F |
| InChI | InChI=1S/2C7H8.BF4/c2*1-2-7-4-3-6(1)5-7;2-1(3,4)5/h2*1-2H,3-5H2;/q;;-1 |
| InChIKey | OVZBAARKHPLWKW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.09 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate?
The IUPAC name of bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate (CID 87568855) is bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate.
What is the SMILES notation for bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate?
The canonical SMILES for bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate is C1=C2CCC(=C1)C2.C1=C2CCC(=C1)C2.F[B-](F)(F)F.
What is the InChIKey of bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate?
The InChIKey is OVZBAARKHPLWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8.BF4/c2*1-2-7-4-3-6(1)5-7;2-1(3,4)5/h2*1-2H,3-5H2;/q;;-1.
What are the key properties of bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate?
bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate has a molecular weight of 271.09 g/mol, XLogP of 5.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bicyclo[2.2.1]hepta-1,3-diene);tetrafluoroborate is sourced from PubChem (CID 87568855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).