About 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane
2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane (PubChem CID 87569587) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane.
Molecular Properties
| Compound Name | 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane |
| PubChem CID | 87569587 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane |
| SMILES | CC(C)=CCC/C(C)=C/C1CO1 |
| InChI | InChI=1S/C11H18O/c1-9(2)5-4-6-10(3)7-11-8-12-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | CVLUQCFBBAQDOH-JXMROGBWSA-N |
| XLogP | 3.08 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane?
The IUPAC name of 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane (CID 87569587) is 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane.
What is the SMILES notation for 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane?
The canonical SMILES for 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane is CC(C)=CCC/C(C)=C/C1CO1.
What is the InChIKey of 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane?
The InChIKey is CVLUQCFBBAQDOH-JXMROGBWSA-N. The full InChI is InChI=1S/C11H18O/c1-9(2)5-4-6-10(3)7-11-8-12-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+.
What are the key properties of 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane?
2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane has a molecular weight of 166.26 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]oxirane is sourced from PubChem (CID 87569587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).