About N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine
N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine (PubChem CID 87569614) has the molecular formula C10H9Br2NO
and a molecular weight of 319.00 g/mol. Its IUPAC name is N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine |
| PubChem CID | 87569614 |
| Molecular Formula | C10H9Br2NO |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 316.91 |
| IUPAC Name | N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1ccc(C=C(Br)Br)cc1 |
| InChI | InChI=1S/C10H9Br2NO/c1-7(13-14)9-4-2-8(3-5-9)6-10(11)12/h2-6,14H,1H3 |
| InChIKey | SPNRWAGYWLADDP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine?
The IUPAC name of N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine (CID 87569614) is N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine.
What is the SMILES notation for N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine?
The canonical SMILES for N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine is CC(=NO)c1ccc(C=C(Br)Br)cc1.
What is the InChIKey of N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine?
The InChIKey is SPNRWAGYWLADDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Br2NO/c1-7(13-14)9-4-2-8(3-5-9)6-10(11)12/h2-6,14H,1H3.
What are the key properties of N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine?
N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine has a molecular weight of 319.00 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(2,2-dibromoethenyl)phenyl]ethylidene]hydroxylamine is sourced from PubChem (CID 87569614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).