C12F23N — CID 87570177
2,2,3,3,4,4,5,5,6-nonafluoro-1-(trifluoromethyl)-6-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine (PubChem CID 87570177) has the molecular formula C12F23N and a molecular weight of 595.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6-nonafluoro-1-(trifluoromethyl)-6-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6-nonafluoro-1-(trifluoromethyl)-6-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine |
|---|---|
| PubChem CID | 87570177 |
| Molecular Formula | C12F23N |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 594.97 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6-nonafluoro-1-(trifluoromethyl)-6-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine |
| SMILES | FC(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F23N/c13-1(2(14,15)4(18,19)6(22,23)5(20,21)3(1,16)17)10(30)8(26,27)7(24,25)9(28,29)11(31,32)36(10)12(33,34)35 |
| InChIKey | OCYNFWXIVLGRIV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|