About copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea
copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea (PubChem CID 87570295) has the molecular formula C7H13CuN6S2
and a molecular weight of 308.90 g/mol. Its IUPAC name is copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea.
Molecular Properties
| Compound Name | copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea |
| PubChem CID | 87570295 |
| Molecular Formula | C7H13CuN6S2 |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea |
| SMILES | [CH2-]C(C=NNC(=S)NC)=NNC(=S)NC.[Cu+] |
| InChI | InChI=1S/C7H13N6S2.Cu/c1-5(11-13-7(15)9-3)4-10-12-6(14)8-2;/h4H,1H2,2-3H3,(H2,8,12,14)(H2,9,13,15);/q-1;+1 |
| InChIKey | MZAJRIQNAUYENA-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea?
The IUPAC name of copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea (CID 87570295) is copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea.
What is the SMILES notation for copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea?
The canonical SMILES for copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea is [CH2-]C(C=NNC(=S)NC)=NNC(=S)NC.[Cu+].
What is the InChIKey of copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea?
The InChIKey is MZAJRIQNAUYENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N6S2.Cu/c1-5(11-13-7(15)9-3)4-10-12-6(14)8-2;/h4H,1H2,2-3H3,(H2,8,12,14)(H2,9,13,15);/q-1;+1.
What are the key properties of copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea?
copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea has a molecular weight of 308.90 g/mol, XLogP of -0.65, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1-methyl-3-[1-(methylcarbamothioylhydrazinylidene)propan-2-ylideneamino]thiourea is sourced from PubChem (CID 87570295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).