C31H42ClN5O2S — CID 87570563
6-chloro-2,4-dimethyl-N-[3-[4-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenyl-2-sulfanylideneimidazolidin-1-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 87570563) has the molecular formula C31H42ClN5O2S and a molecular weight of 584.23 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-N-[3-[4-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenyl-2-sulfanylideneimidazolidin-1-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-2,4-dimethyl-N-[3-[4-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenyl-2-sulfanylideneimidazolidin-1-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87570563 |
| Molecular Formula | C31H42ClN5O2S |
| Molecular Weight | 584.23 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 6-chloro-2,4-dimethyl-N-[3-[4-[3-[[(2R)-oxolan-2-yl]methyl]-5-phenyl-2-sulfanylideneimidazolidin-1-yl]piperidin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCCC(C)N1CCC(N2C(=S)N(C[C@H]3CCCO3)CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C31H42ClN5O2S/c1-21-18-28(32)34-23(3)29(21)30(38)33-14-11-22(2)35-15-12-25(13-16-35)37-27(24-8-5-4-6-9-24)20-36(31(37)40)19-26-10-7-17-39-26/h4-6,8-9,18,22,25-27H,7,10-17,19-20H2,1-3H3,(H,33,38)/t22?,26-,27?/m1/s1 |
| InChIKey | BJTRXVRCNGPIMK-MVXOQVLLSA-N |
| XLogP | 5.15 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.23 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|