C22H28N2O4 — CID 87571518
tert-butyl 2-[[(1S,2S)-2-prop-2-ynoxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 87571518) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl 2-[[(1S,2S)-2-prop-2-ynoxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(1S,2S)-2-prop-2-ynoxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87571518 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl 2-[[(1S,2S)-2-prop-2-ynoxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C#CCO[C@H]1Cc2ccccc2[C@@H]1NC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28N2O4/c1-5-13-27-18-14-15-9-6-7-10-16(15)19(18)23-20(25)17-11-8-12-24(17)21(26)28-22(2,3)4/h1,6-7,9-10,17-19H,8,11-14H2,2-4H3,(H,23,25)/t17?,18-,19-/m0/s1 |
| InChIKey | OHVAONJKTPXWOF-MNNMKWMVSA-N |
| XLogP | 2.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|