About 2,8-dihydroxanthene-1,7,9-trione
2,8-dihydroxanthene-1,7,9-trione (PubChem CID 87571612) has the molecular formula C13H8O4
and a molecular weight of 228.20 g/mol. Its IUPAC name is 2,8-dihydroxanthene-1,7,9-trione.
Molecular Properties
| Compound Name | 2,8-dihydroxanthene-1,7,9-trione |
| PubChem CID | 87571612 |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2,8-dihydroxanthene-1,7,9-trione |
| SMILES | O=C1C=Cc2oc3c(c(=O)c2C1)C(=O)CC=C3 |
| InChI | InChI=1S/C13H8O4/c14-7-4-5-10-8(6-7)13(16)12-9(15)2-1-3-11(12)17-10/h1,3-5H,2,6H2 |
| InChIKey | JABOLFPTWAFPLO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,8-dihydroxanthene-1,7,9-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dihydroxanthene-1,7,9-trione?
The IUPAC name of 2,8-dihydroxanthene-1,7,9-trione (CID 87571612) is 2,8-dihydroxanthene-1,7,9-trione.
What is the SMILES notation for 2,8-dihydroxanthene-1,7,9-trione?
The canonical SMILES for 2,8-dihydroxanthene-1,7,9-trione is O=C1C=Cc2oc3c(c(=O)c2C1)C(=O)CC=C3.
What is the InChIKey of 2,8-dihydroxanthene-1,7,9-trione?
The InChIKey is JABOLFPTWAFPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O4/c14-7-4-5-10-8(6-7)13(16)12-9(15)2-1-3-11(12)17-10/h1,3-5H,2,6H2.
What are the key properties of 2,8-dihydroxanthene-1,7,9-trione?
2,8-dihydroxanthene-1,7,9-trione has a molecular weight of 228.20 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dihydroxanthene-1,7,9-trione is sourced from PubChem (CID 87571612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).