C17H13F2N3OS — CID 87571807
2-[[(2S,3R)-3-(2-fluorophenyl)-2-(3-fluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 87571807) has the molecular formula C17H13F2N3OS and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-(2-fluorophenyl)-2-(3-fluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2S,3R)-3-(2-fluorophenyl)-2-(3-fluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 87571807 |
| Molecular Formula | C17H13F2N3OS |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[[(2S,3R)-3-(2-fluorophenyl)-2-(3-fluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | Fc1cccc([C@@]2(Cn3[nH]cnc3=S)O[C@@H]2c2ccccc2F)c1 |
| InChI | InChI=1S/C17H13F2N3OS/c18-12-5-3-4-11(8-12)17(9-22-16(24)20-10-21-22)15(23-17)13-6-1-2-7-14(13)19/h1-8,10,15H,9H2,(H,20,21,24)/t15-,17-/m1/s1 |
| InChIKey | JXPYRFFOGYXVPK-NVXWUHKLSA-N |
| XLogP | 3.89 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|