About 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol
2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol (PubChem CID 87572087) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol |
| PubChem CID | 87572087 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol |
| SMILES | C=CCNC(CN(C)CCO)NCC=C |
| InChI | InChI=1S/C11H23N3O/c1-4-6-12-11(13-7-5-2)10-14(3)8-9-15/h4-5,11-13,15H,1-2,6-10H2,3H3 |
| InChIKey | KMOBEDBIATWQGQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol?
The IUPAC name of 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol (CID 87572087) is 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol.
What is the SMILES notation for 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol?
The canonical SMILES for 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol is C=CCNC(CN(C)CCO)NCC=C.
What is the InChIKey of 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol?
The InChIKey is KMOBEDBIATWQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-4-6-12-11(13-7-5-2)10-14(3)8-9-15/h4-5,11-13,15H,1-2,6-10H2,3H3.
What are the key properties of 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol?
2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol has a molecular weight of 213.32 g/mol, XLogP of -0.21, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-bis(prop-2-enylamino)ethyl-methylamino]ethanol is sourced from PubChem (CID 87572087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).