About 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid
2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid (PubChem CID 87572402) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid |
| PubChem CID | 87572402 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid |
| SMILES | C[C@H]1/C=C(/CC(=O)O)CCCCCCCCCCCC1 |
| InChI | InChI=1S/C18H32O2/c1-16-12-10-8-6-4-2-3-5-7-9-11-13-17(14-16)15-18(19)20/h14,16H,2-13,15H2,1H3,(H,19,20)/b17-14+/t16-/m1/s1 |
| InChIKey | APNIRANAUXUBLB-WECAROLCSA-N |
| XLogP | 5.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid?
The IUPAC name of 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid (CID 87572402) is 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid.
What is the SMILES notation for 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid?
The canonical SMILES for 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid is C[C@H]1/C=C(/CC(=O)O)CCCCCCCCCCCC1.
What is the InChIKey of 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid?
The InChIKey is APNIRANAUXUBLB-WECAROLCSA-N. The full InChI is InChI=1S/C18H32O2/c1-16-12-10-8-6-4-2-3-5-7-9-11-13-17(14-16)15-18(19)20/h14,16H,2-13,15H2,1H3,(H,19,20)/b17-14+/t16-/m1/s1.
What are the key properties of 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid?
2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid has a molecular weight of 280.45 g/mol, XLogP of 5.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E,3R)-3-methylcyclopentadecen-1-yl]acetic acid is sourced from PubChem (CID 87572402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).