C17H39NSi2 — CID 87572927
1-[ethenyl(dimethyl)silyl]-N-[tri(propan-2-yl)silylmethyl]propan-1-amine (PubChem CID 87572927) has the molecular formula C17H39NSi2 and a molecular weight of 313.68 g/mol. Its IUPAC name is 1-[ethenyl(dimethyl)silyl]-N-[tri(propan-2-yl)silylmethyl]propan-1-amine.
| Compound Name | 1-[ethenyl(dimethyl)silyl]-N-[tri(propan-2-yl)silylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 87572927 |
| Molecular Formula | C17H39NSi2 |
| Molecular Weight | 313.68 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | 1-[ethenyl(dimethyl)silyl]-N-[tri(propan-2-yl)silylmethyl]propan-1-amine |
| SMILES | C=C[Si](C)(C)C(CC)NC[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H39NSi2/c1-11-17(19(9,10)12-2)18-13-20(14(3)4,15(5)6)16(7)8/h12,14-18H,2,11,13H2,1,3-10H3 |
| InChIKey | FKWRYVGTSLIYOC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|