C11H23N3O3 — CID 87572949
N,N-dimethoxy-4-morpholin-4-ylpiperidin-4-amine (PubChem CID 87572949) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is N,N-dimethoxy-4-morpholin-4-ylpiperidin-4-amine.
| Compound Name | N,N-dimethoxy-4-morpholin-4-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 87572949 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | N,N-dimethoxy-4-morpholin-4-ylpiperidin-4-amine |
| SMILES | CON(OC)C1(N2CCOCC2)CCNCC1 |
| InChI | InChI=1S/C11H23N3O3/c1-15-14(16-2)11(3-5-12-6-4-11)13-7-9-17-10-8-13/h12H,3-10H2,1-2H3 |
| InChIKey | INRLTZWCBDITNH-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|