About cyanamide;tributyl(octyl)phosphanium
cyanamide;tributyl(octyl)phosphanium (PubChem CID 87573040) has the molecular formula C22H48N4P+
and a molecular weight of 399.63 g/mol. Its IUPAC name is cyanamide;tributyl(octyl)phosphanium.
Molecular Properties
| Compound Name | cyanamide;tributyl(octyl)phosphanium |
| PubChem CID | 87573040 |
| Molecular Formula | C22H48N4P+ |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.36 |
| IUPAC Name | cyanamide;tributyl(octyl)phosphanium |
| SMILES | CCCCCCCC[P+](CCCC)(CCCC)CCCC.N#CN.N#CN |
| InChI | InChI=1S/C20H44P.2CH2N2/c1-5-9-13-14-15-16-20-21(17-10-6-2,18-11-7-3)19-12-8-4;2*2-1-3/h5-20H2,1-4H3;2*2H2/q+1;; |
| InChIKey | ZEGIQJXTMJSNHF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyanamide;tributyl(octyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanamide;tributyl(octyl)phosphanium?
The IUPAC name of cyanamide;tributyl(octyl)phosphanium (CID 87573040) is cyanamide;tributyl(octyl)phosphanium.
What is the SMILES notation for cyanamide;tributyl(octyl)phosphanium?
The canonical SMILES for cyanamide;tributyl(octyl)phosphanium is CCCCCCCC[P+](CCCC)(CCCC)CCCC.N#CN.N#CN.
What is the InChIKey of cyanamide;tributyl(octyl)phosphanium?
The InChIKey is ZEGIQJXTMJSNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44P.2CH2N2/c1-5-9-13-14-15-16-20-21(17-10-6-2,18-11-7-3)19-12-8-4;2*2-1-3/h5-20H2,1-4H3;2*2H2/q+1;;.
What are the key properties of cyanamide;tributyl(octyl)phosphanium?
cyanamide;tributyl(octyl)phosphanium has a molecular weight of 399.63 g/mol, XLogP of 6.62, 16 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanamide;tributyl(octyl)phosphanium is sourced from PubChem (CID 87573040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).