About 4-cyclohexyl-5,7-dihydroxychromen-2-one
4-cyclohexyl-5,7-dihydroxychromen-2-one (PubChem CID 87573442) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-cyclohexyl-5,7-dihydroxychromen-2-one.
Molecular Properties
| Compound Name | 4-cyclohexyl-5,7-dihydroxychromen-2-one |
| PubChem CID | 87573442 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-cyclohexyl-5,7-dihydroxychromen-2-one |
| SMILES | O=c1cc(C2CCCCC2)c2c(O)cc(O)cc2o1 |
| InChI | InChI=1S/C15H16O4/c16-10-6-12(17)15-11(9-4-2-1-3-5-9)8-14(18)19-13(15)7-10/h6-9,16-17H,1-5H2 |
| InChIKey | XDZDFDDMHOFMEE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyl-5,7-dihydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-5,7-dihydroxychromen-2-one?
The IUPAC name of 4-cyclohexyl-5,7-dihydroxychromen-2-one (CID 87573442) is 4-cyclohexyl-5,7-dihydroxychromen-2-one.
What is the SMILES notation for 4-cyclohexyl-5,7-dihydroxychromen-2-one?
The canonical SMILES for 4-cyclohexyl-5,7-dihydroxychromen-2-one is O=c1cc(C2CCCCC2)c2c(O)cc(O)cc2o1.
What is the InChIKey of 4-cyclohexyl-5,7-dihydroxychromen-2-one?
The InChIKey is XDZDFDDMHOFMEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4/c16-10-6-12(17)15-11(9-4-2-1-3-5-9)8-14(18)19-13(15)7-10/h6-9,16-17H,1-5H2.
What are the key properties of 4-cyclohexyl-5,7-dihydroxychromen-2-one?
4-cyclohexyl-5,7-dihydroxychromen-2-one has a molecular weight of 260.29 g/mol, XLogP of 3.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-5,7-dihydroxychromen-2-one is sourced from PubChem (CID 87573442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).