C26H38N2O10 — CID 87573758
ethyl [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate (PubChem CID 87573758) has the molecular formula C26H38N2O10 and a molecular weight of 538.59 g/mol. Its IUPAC name is ethyl [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate.
| Compound Name | ethyl [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 87573758 |
| Molecular Formula | C26H38N2O10 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | ethyl [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
| SMILES | CCOC(=O)OC[C@H]1O[C@@](O)(Oc2nn(C(C)C)c(C)c2Cc2ccc(OC(C)C)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H38N2O10/c1-7-34-25(32)35-13-20-21(29)22(30)23(31)26(33,37-20)38-24-19(16(6)28(27-24)14(2)3)12-17-8-10-18(11-9-17)36-15(4)5/h8-11,14-15,20-23,29-31,33H,7,12-13H2,1-6H3/t20-,21-,22+,23-,26-/m1/s1 |
| InChIKey | LJUCDMSYUMDZLJ-MYIDKPJBSA-N |
| XLogP | 1.83 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|