About 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile
1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile (PubChem CID 87574014) has the molecular formula C14H15ClN4O2
and a molecular weight of 306.75 g/mol. Its IUPAC name is 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile |
| PubChem CID | 87574014 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile |
| SMILES | N#CC1(CCO)CCN(c2nc(Cl)nc3ccoc23)CC1 |
| InChI | InChI=1S/C14H15ClN4O2/c15-13-17-10-1-8-21-11(10)12(18-13)19-5-2-14(9-16,3-6-19)4-7-20/h1,8,20H,2-7H2 |
| InChIKey | SZTDEFGTPQSJLP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile?
The IUPAC name of 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile (CID 87574014) is 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile.
What is the SMILES notation for 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile?
The canonical SMILES for 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile is N#CC1(CCO)CCN(c2nc(Cl)nc3ccoc23)CC1.
What is the InChIKey of 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile?
The InChIKey is SZTDEFGTPQSJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN4O2/c15-13-17-10-1-8-21-11(10)12(18-13)19-5-2-14(9-16,3-6-19)4-7-20/h1,8,20H,2-7H2.
What are the key properties of 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile?
1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile has a molecular weight of 306.75 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)-4-(2-hydroxyethyl)piperidine-4-carbonitrile is sourced from PubChem (CID 87574014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).