C10H11F7O3 — CID 87574056
4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methylpent-2-enoic acid (PubChem CID 87574056) has the molecular formula C10H11F7O3 and a molecular weight of 312.18 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methylpent-2-enoic acid.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 87574056 |
| Molecular Formula | C10H11F7O3 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-methylpent-2-enoic acid |
| SMILES | CC(=CC(C)OCC(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H11F7O3/c1-5(7(18)19)3-6(2)20-4-8(11,12)9(13,14)10(15,16)17/h3,6H,4H2,1-2H3,(H,18,19) |
| InChIKey | KWUUCJJCHATQPZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|