About pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate
pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 87574178) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate.
Molecular Properties
| Compound Name | pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| PubChem CID | 87574178 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | C=CC(CC)OC(=O)C1CC2OC2C1 |
| InChI | InChI=1S/C11H16O3/c1-3-8(4-2)13-11(12)7-5-9-10(6-7)14-9/h3,7-10H,1,4-6H2,2H3 |
| InChIKey | NBQSSOFVDHWDAE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
The IUPAC name of pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate (CID 87574178) is pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate.
What is the SMILES notation for pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
The canonical SMILES for pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate is C=CC(CC)OC(=O)C1CC2OC2C1.
What is the InChIKey of pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
The InChIKey is NBQSSOFVDHWDAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-3-8(4-2)13-11(12)7-5-9-10(6-7)14-9/h3,7-10H,1,4-6H2,2H3.
What are the key properties of pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-1-en-3-yl 6-oxabicyclo[3.1.0]hexane-3-carboxylate is sourced from PubChem (CID 87574178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).