About 1-ethoxyethyl 2-pent-4-enylhept-6-enoate
1-ethoxyethyl 2-pent-4-enylhept-6-enoate (PubChem CID 87574190) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-ethoxyethyl 2-pent-4-enylhept-6-enoate.
Molecular Properties
| Compound Name | 1-ethoxyethyl 2-pent-4-enylhept-6-enoate |
| PubChem CID | 87574190 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-ethoxyethyl 2-pent-4-enylhept-6-enoate |
| SMILES | C=CCCCC(CCCC=C)C(=O)OC(C)OCC |
| InChI | InChI=1S/C16H28O3/c1-5-8-10-12-15(13-11-9-6-2)16(17)19-14(4)18-7-3/h5-6,14-15H,1-2,7-13H2,3-4H3 |
| InChIKey | SBZUZHKDNMNZDL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethyl 2-pent-4-enylhept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethyl 2-pent-4-enylhept-6-enoate?
The IUPAC name of 1-ethoxyethyl 2-pent-4-enylhept-6-enoate (CID 87574190) is 1-ethoxyethyl 2-pent-4-enylhept-6-enoate.
What is the SMILES notation for 1-ethoxyethyl 2-pent-4-enylhept-6-enoate?
The canonical SMILES for 1-ethoxyethyl 2-pent-4-enylhept-6-enoate is C=CCCCC(CCCC=C)C(=O)OC(C)OCC.
What is the InChIKey of 1-ethoxyethyl 2-pent-4-enylhept-6-enoate?
The InChIKey is SBZUZHKDNMNZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-5-8-10-12-15(13-11-9-6-2)16(17)19-14(4)18-7-3/h5-6,14-15H,1-2,7-13H2,3-4H3.
What are the key properties of 1-ethoxyethyl 2-pent-4-enylhept-6-enoate?
1-ethoxyethyl 2-pent-4-enylhept-6-enoate has a molecular weight of 268.40 g/mol, XLogP of 4.24, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethyl 2-pent-4-enylhept-6-enoate is sourced from PubChem (CID 87574190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).