About 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate
2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 87574246) has the molecular formula C9H11BrO3
and a molecular weight of 247.09 g/mol. Its IUPAC name is 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate.
Molecular Properties
| Compound Name | 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| PubChem CID | 87574246 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | C=C(Br)COC(=O)C1CC2OC2C1 |
| InChI | InChI=1S/C9H11BrO3/c1-5(10)4-12-9(11)6-2-7-8(3-6)13-7/h6-8H,1-4H2 |
| InChIKey | AWYJGLSXDPQPLX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
The IUPAC name of 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate (CID 87574246) is 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate.
What is the SMILES notation for 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
The canonical SMILES for 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate is C=C(Br)COC(=O)C1CC2OC2C1.
What is the InChIKey of 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
The InChIKey is AWYJGLSXDPQPLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO3/c1-5(10)4-12-9(11)6-2-7-8(3-6)13-7/h6-8H,1-4H2.
What are the key properties of 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate?
2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate has a molecular weight of 247.09 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoprop-2-enyl 6-oxabicyclo[3.1.0]hexane-3-carboxylate is sourced from PubChem (CID 87574246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).