C36H41F9O5S2 — CID 87574592
[bis(4-tert-butylphenyl)-[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87574592) has the molecular formula C36H41F9O5S2 and a molecular weight of 788.83 g/mol. Its IUPAC name is [bis(4-tert-butylphenyl)-[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [bis(4-tert-butylphenyl)-[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87574592 |
| Molecular Formula | C36H41F9O5S2 |
| Molecular Weight | 788.83 g/mol |
| Exact Mass | 788.23 |
| IUPAC Name | [bis(4-tert-butylphenyl)-[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | C=COCCOc1c(C)cc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C36H41F9O5S2/c1-10-48-19-20-49-30-23(2)21-29(22-24(30)3)51(27-15-11-25(12-16-27)31(4,5)6,28-17-13-26(14-18-28)32(7,8)9)50-52(46,47)36(44,45)34(39,40)33(37,38)35(41,42)43/h10-18,21-22H,1,19-20H2,2-9H3 |
| InChIKey | WLWJUGSNXWEYLZ-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.83 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|