About 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde
2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde (PubChem CID 87574648) has the molecular formula C26H26FNO
and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde |
| PubChem CID | 87574648 |
| Molecular Formula | C26H26FNO |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde |
| SMILES | CC1(C)CCN(Cc2ccccc2)c2cc(CC=O)c(-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C26H26FNO/c1-26(2)13-14-28(18-19-6-4-3-5-7-19)25-16-21(12-15-29)23(17-24(25)26)20-8-10-22(27)11-9-20/h3-11,15-17H,12-14,18H2,1-2H3 |
| InChIKey | XUYLYRZLGCWEBF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde?
The IUPAC name of 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde (CID 87574648) is 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde.
What is the SMILES notation for 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde?
The canonical SMILES for 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde is CC1(C)CCN(Cc2ccccc2)c2cc(CC=O)c(-c3ccc(F)cc3)cc21.
What is the InChIKey of 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde?
The InChIKey is XUYLYRZLGCWEBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26FNO/c1-26(2)13-14-28(18-19-6-4-3-5-7-19)25-16-21(12-15-29)23(17-24(25)26)20-8-10-22(27)11-9-20/h3-11,15-17H,12-14,18H2,1-2H3.
What are the key properties of 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde?
2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde has a molecular weight of 387.50 g/mol, XLogP of 5.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-benzyl-6-(4-fluorophenyl)-4,4-dimethyl-2,3-dihydroquinolin-7-yl]acetaldehyde is sourced from PubChem (CID 87574648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).