About 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline
4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline (PubChem CID 87574651) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline |
| PubChem CID | 87574651 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline |
| SMILES | COc1c(N)c(OC)c(OC)c(-c2ccc(N)cc2)c1OC |
| InChI | InChI=1S/C16H20N2O4/c1-19-13-11(9-5-7-10(17)8-6-9)14(20-2)16(22-4)12(18)15(13)21-3/h5-8H,17-18H2,1-4H3 |
| InChIKey | IGPUXDFWGUYOMP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline?
The IUPAC name of 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline (CID 87574651) is 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline.
What is the SMILES notation for 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline?
The canonical SMILES for 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline is COc1c(N)c(OC)c(OC)c(-c2ccc(N)cc2)c1OC.
What is the InChIKey of 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline?
The InChIKey is IGPUXDFWGUYOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4/c1-19-13-11(9-5-7-10(17)8-6-9)14(20-2)16(22-4)12(18)15(13)21-3/h5-8H,17-18H2,1-4H3.
What are the key properties of 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline?
4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline has a molecular weight of 304.35 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-2,3,5,6-tetramethoxyaniline is sourced from PubChem (CID 87574651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).