C20H34S — CID 87575042
(2E)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3,7-dimethylocta-2,6-diene (PubChem CID 87575042) has the molecular formula C20H34S and a molecular weight of 306.56 g/mol. Its IUPAC name is (2E)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3,7-dimethylocta-2,6-diene.
| Compound Name | (2E)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 87575042 |
| Molecular Formula | C20H34S |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | (2E)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanyl-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CSC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H34S/c1-17(2)9-7-11-19(5)13-15-21-16-14-20(6)12-8-10-18(3)4/h9-10,13-14H,7-8,11-12,15-16H2,1-6H3/b19-13+,20-14+ |
| InChIKey | SLHQMOXKVRZRET-IWGRKNQJSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|