C6HF9S — CID 87575118
pentafluoro-(2,3,5,6-tetrafluorophenyl)-λ6-sulfane (PubChem CID 87575118) has the molecular formula C6HF9S and a molecular weight of 276.12 g/mol. Its IUPAC name is pentafluoro-(2,3,5,6-tetrafluorophenyl)-λ6-sulfane.
| Compound Name | pentafluoro-(2,3,5,6-tetrafluorophenyl)-λ6-sulfane |
|---|---|
| PubChem CID | 87575118 |
| Molecular Formula | C6HF9S |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | pentafluoro-(2,3,5,6-tetrafluorophenyl)-λ6-sulfane |
| SMILES | Fc1cc(F)c(F)c(S(F)(F)(F)(F)F)c1F |
| InChI | InChI=1S/C6HF9S/c7-2-1-3(8)5(10)6(4(2)9)16(11,12,13,14)15/h1H |
| InChIKey | XIGUSVPRPZCBIZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|