About tris[(E)-oct-1-enyl] phosphate
tris[(E)-oct-1-enyl] phosphate (PubChem CID 87576001) has the molecular formula C24H45O4P
and a molecular weight of 428.59 g/mol. Its IUPAC name is tris[(E)-oct-1-enyl] phosphate.
Molecular Properties
| Compound Name | tris[(E)-oct-1-enyl] phosphate |
| PubChem CID | 87576001 |
| Molecular Formula | C24H45O4P |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | tris[(E)-oct-1-enyl] phosphate |
| SMILES | CCCCCC/C=C/OP(=O)(O/C=C/CCCCCC)O/C=C/CCCCCC |
| InChI | InChI=1S/C24H45O4P/c1-4-7-10-13-16-19-22-26-29(25,27-23-20-17-14-11-8-5-2)28-24-21-18-15-12-9-6-3/h19-24H,4-18H2,1-3H3/b22-19+,23-20+,24-21+ |
| InChIKey | UTRCHPITLNRWGO-IKVQWSBMSA-N |
| XLogP | 9.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[(E)-oct-1-enyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(E)-oct-1-enyl] phosphate?
The IUPAC name of tris[(E)-oct-1-enyl] phosphate (CID 87576001) is tris[(E)-oct-1-enyl] phosphate.
What is the SMILES notation for tris[(E)-oct-1-enyl] phosphate?
The canonical SMILES for tris[(E)-oct-1-enyl] phosphate is CCCCCC/C=C/OP(=O)(O/C=C/CCCCCC)O/C=C/CCCCCC.
What is the InChIKey of tris[(E)-oct-1-enyl] phosphate?
The InChIKey is UTRCHPITLNRWGO-IKVQWSBMSA-N. The full InChI is InChI=1S/C24H45O4P/c1-4-7-10-13-16-19-22-26-29(25,27-23-20-17-14-11-8-5-2)28-24-21-18-15-12-9-6-3/h19-24H,4-18H2,1-3H3/b22-19+,23-20+,24-21+.
What are the key properties of tris[(E)-oct-1-enyl] phosphate?
tris[(E)-oct-1-enyl] phosphate has a molecular weight of 428.59 g/mol, XLogP of 9.60, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(E)-oct-1-enyl] phosphate is sourced from PubChem (CID 87576001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).