About sulfo (2E)-2-methylhexa-2,5-dienoate
sulfo (2E)-2-methylhexa-2,5-dienoate (PubChem CID 87576331) has the molecular formula C7H10O5S
and a molecular weight of 206.22 g/mol. Its IUPAC name is sulfo (2E)-2-methylhexa-2,5-dienoate.
Molecular Properties
| Compound Name | sulfo (2E)-2-methylhexa-2,5-dienoate |
| PubChem CID | 87576331 |
| Molecular Formula | C7H10O5S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | sulfo (2E)-2-methylhexa-2,5-dienoate |
| SMILES | C=CC/C=C(\C)C(=O)OS(=O)(=O)O |
| InChI | InChI=1S/C7H10O5S/c1-3-4-5-6(2)7(8)12-13(9,10)11/h3,5H,1,4H2,2H3,(H,9,10,11)/b6-5+ |
| InChIKey | ICHIIWUSRYSBNY-AATRIKPKSA-N |
| XLogP | 0.85 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfo (2E)-2-methylhexa-2,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfo (2E)-2-methylhexa-2,5-dienoate?
The IUPAC name of sulfo (2E)-2-methylhexa-2,5-dienoate (CID 87576331) is sulfo (2E)-2-methylhexa-2,5-dienoate.
What is the SMILES notation for sulfo (2E)-2-methylhexa-2,5-dienoate?
The canonical SMILES for sulfo (2E)-2-methylhexa-2,5-dienoate is C=CC/C=C(\C)C(=O)OS(=O)(=O)O.
What is the InChIKey of sulfo (2E)-2-methylhexa-2,5-dienoate?
The InChIKey is ICHIIWUSRYSBNY-AATRIKPKSA-N. The full InChI is InChI=1S/C7H10O5S/c1-3-4-5-6(2)7(8)12-13(9,10)11/h3,5H,1,4H2,2H3,(H,9,10,11)/b6-5+.
What are the key properties of sulfo (2E)-2-methylhexa-2,5-dienoate?
sulfo (2E)-2-methylhexa-2,5-dienoate has a molecular weight of 206.22 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfo (2E)-2-methylhexa-2,5-dienoate is sourced from PubChem (CID 87576331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).