About lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate
lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate (PubChem CID 87576337) has the molecular formula C2F5LiO3S
and a molecular weight of 206.02 g/mol. Its IUPAC name is lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate.
Molecular Properties
| Compound Name | lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate |
|---|
| PubChem CID | 87576337 |
|---|
| Molecular Formula | C2F5LiO3S |
|---|
| Molecular Weight | 206.02 g/mol |
|---|
| Exact Mass | 205.96 |
|---|
| IUPAC Name | lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate |
|---|
| SMILES | O=S(=O)(OF)[C-](F)C(F)(F)F.[Li+] |
|---|
| InChI | InChI=1S/C2F5O3S.Li/c3-1(2(4,5)6)11(8,9)10-7;/q-1;+1 |
|---|
| InChIKey | OHKGOYQVDUKLMU-UHFFFAOYSA-N |
|---|
| XLogP | -1.76 |
|---|
| TPSA | 43.37 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 12 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 206.02 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate?
The IUPAC name of lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate (CID 87576337) is lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate.
What is the SMILES notation for lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate?
The canonical SMILES for lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate is O=S(=O)(OF)[C-](F)C(F)(F)F.[Li+].
What is the InChIKey of lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate?
The InChIKey is OHKGOYQVDUKLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F5O3S.Li/c3-1(2(4,5)6)11(8,9)10-7;/q-1;+1.
What are the key properties of lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate?
lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate has a molecular weight of 206.02 g/mol, XLogP of -1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium fluoro 1,2,2,2-tetrafluoroethanesulfonate is sourced from PubChem (CID 87576337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).