About 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione
3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione (PubChem CID 87576825) has the molecular formula C8H8N2O4S4
and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione |
| PubChem CID | 87576825 |
| Molecular Formula | C8H8N2O4S4 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(SSSSC2CC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C8H8N2O4S4/c11-5-1-3(7(13)9-5)15-17-18-16-4-2-6(12)10-8(4)14/h3-4H,1-2H2,(H,9,11,13)(H,10,12,14) |
| InChIKey | VMHVSFWIJBMBML-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione?
The IUPAC name of 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione (CID 87576825) is 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione.
What is the SMILES notation for 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione?
The canonical SMILES for 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione is O=C1CC(SSSSC2CC(=O)NC2=O)C(=O)N1.
What is the InChIKey of 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione?
The InChIKey is VMHVSFWIJBMBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4S4/c11-5-1-3(7(13)9-5)15-17-18-16-4-2-6(12)10-8(4)14/h3-4H,1-2H2,(H,9,11,13)(H,10,12,14).
What are the key properties of 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione?
3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione has a molecular weight of 324.43 g/mol, XLogP of 0.49, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dioxopyrrolidin-3-yl)tetrasulfanyl]pyrrolidine-2,5-dione is sourced from PubChem (CID 87576825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).