About (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol
(2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol (PubChem CID 87576855) has the molecular formula C7H9ClN4O
and a molecular weight of 200.63 g/mol. Its IUPAC name is (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol.
Molecular Properties
| Compound Name | (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol |
| PubChem CID | 87576855 |
| Molecular Formula | C7H9ClN4O |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol |
| SMILES | Nc1nc(Cl)c2c(n1)NCC2CO |
| InChI | InChI=1S/C7H9ClN4O/c8-5-4-3(2-13)1-10-6(4)12-7(9)11-5/h3,13H,1-2H2,(H3,9,10,11,12) |
| InChIKey | AUXXUBFWDQZPBF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol?
The IUPAC name of (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol (CID 87576855) is (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol.
What is the SMILES notation for (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol?
The canonical SMILES for (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol is Nc1nc(Cl)c2c(n1)NCC2CO.
What is the InChIKey of (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol?
The InChIKey is AUXXUBFWDQZPBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN4O/c8-5-4-3(2-13)1-10-6(4)12-7(9)11-5/h3,13H,1-2H2,(H3,9,10,11,12).
What are the key properties of (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol?
(2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol has a molecular weight of 200.63 g/mol, XLogP of 0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-5-yl)methanol is sourced from PubChem (CID 87576855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).