C18H16Cl2FNO5S — CID 87576864
(1R,2R,4S)-4-(2-chloro-4-fluorophenyl)sulfonyl-2-[(6-chloro-3-pyridinyl)oxymethyl]cyclopentane-1-carboxylic acid (PubChem CID 87576864) has the molecular formula C18H16Cl2FNO5S and a molecular weight of 448.30 g/mol. Its IUPAC name is (1R,2R,4S)-4-(2-chloro-4-fluorophenyl)sulfonyl-2-[(6-chloro-3-pyridinyl)oxymethyl]cyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,4S)-4-(2-chloro-4-fluorophenyl)sulfonyl-2-[(6-chloro-3-pyridinyl)oxymethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 87576864 |
| Molecular Formula | C18H16Cl2FNO5S |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | (1R,2R,4S)-4-(2-chloro-4-fluorophenyl)sulfonyl-2-[(6-chloro-3-pyridinyl)oxymethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H](S(=O)(=O)c2ccc(F)cc2Cl)C[C@H]1COc1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H16Cl2FNO5S/c19-15-6-11(21)1-3-16(15)28(25,26)13-5-10(14(7-13)18(23)24)9-27-12-2-4-17(20)22-8-12/h1-4,6,8,10,13-14H,5,7,9H2,(H,23,24)/t10-,13-,14+/m0/s1 |
| InChIKey | DNOVGYGVEKHQCN-LEWSCRJBSA-N |
| XLogP | 3.86 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|