C22H31N3O7 — CID 87576869
1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione;6-formamidohexanoic acid (PubChem CID 87576869) has the molecular formula C22H31N3O7 and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione;6-formamidohexanoic acid.
| Compound Name | 1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione;6-formamidohexanoic acid |
|---|---|
| PubChem CID | 87576869 |
| Molecular Formula | C22H31N3O7 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione;6-formamidohexanoic acid |
| SMILES | O=C1C=CC(=O)N1CC1CCC(N2C(=O)CCC2=O)CC1.O=CNCCCCCC(=O)O |
| InChI | InChI=1S/C15H18N2O4.C7H13NO3/c18-12-5-6-13(19)16(12)9-10-1-3-11(4-2-10)17-14(20)7-8-15(17)21;9-6-8-5-3-1-2-4-7(10)11/h5-6,10-11H,1-4,7-9H2;6H,1-5H2,(H,8,9)(H,10,11) |
| InChIKey | NVPPKKYZASWRBL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|