C16H20ClN5O2 — CID 87577064
6-chloro-2-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5-(oxiran-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 87577064) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 6-chloro-2-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5-(oxiran-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5-(oxiran-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87577064 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 6-chloro-2-N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5-(oxiran-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | COc1c(C)cnc(CNc2nc(N)c(CC3CO3)c(Cl)n2)c1C |
| InChI | InChI=1S/C16H20ClN5O2/c1-8-5-19-12(9(2)13(8)23-3)6-20-16-21-14(17)11(15(18)22-16)4-10-7-24-10/h5,10H,4,6-7H2,1-3H3,(H3,18,20,21,22) |
| InChIKey | GNEPKVAKEDWSQP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|