C23H19ClF5N5O3 — CID 87577068
(2,3,4,5,6-pentafluorophenyl) 2-[(5R)-2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]acetate (PubChem CID 87577068) has the molecular formula C23H19ClF5N5O3 and a molecular weight of 543.88 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[(5R)-2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[(5R)-2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 87577068 |
| Molecular Formula | C23H19ClF5N5O3 |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[(5R)-2-amino-4-chloro-7-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-5-yl]acetate |
| SMILES | COc1c(C)cnc(CN2C[C@H](CC(=O)Oc3c(F)c(F)c(F)c(F)c3F)c3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C23H19ClF5N5O3/c1-8-5-31-11(9(2)19(8)36-3)7-34-6-10(13-21(24)32-23(30)33-22(13)34)4-12(35)37-20-17(28)15(26)14(25)16(27)18(20)29/h5,10H,4,6-7H2,1-3H3,(H2,30,32,33)/t10-/m0/s1 |
| InChIKey | BUUKMRIVTJBCOM-JTQLQIEISA-N |
| XLogP | 4.53 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|