C14H16NO4- — CID 8757711
(E)-4-[4-(2-methylpropoxy)anilino]-4-oxobut-2-enoate (PubChem CID 8757711) has the molecular formula C14H16NO4- and a molecular weight of 262.29 g/mol. Its IUPAC name is (E)-4-[4-(2-methylpropoxy)anilino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[4-(2-methylpropoxy)anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 8757711 |
| Molecular Formula | C14H16NO4- |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (E)-4-[4-(2-methylpropoxy)anilino]-4-oxobut-2-enoate |
| SMILES | CC(C)COc1ccc(NC(=O)/C=C/C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H17NO4/c1-10(2)9-19-12-5-3-11(4-6-12)15-13(16)7-8-14(17)18/h3-8,10H,9H2,1-2H3,(H,15,16)(H,17,18)/p-1/b8-7+ |
| InChIKey | BAVDWBUETLJHRE-BQYQJAHWSA-M |
| XLogP | 0.97 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|