C22H34ClN5O3Si — CID 87577110
5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-7-[(5-methoxy-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 87577110) has the molecular formula C22H34ClN5O3Si and a molecular weight of 480.09 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-7-[(5-methoxy-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-7-[(5-methoxy-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 87577110 |
| Molecular Formula | C22H34ClN5O3Si |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-7-[(5-methoxy-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)methyl]-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | COc1c(C)c(CN2CC(CO[Si](C)(C)C(C)(C)C)c3c(Cl)nc(N)nc32)c[n+]([O-])c1C |
| InChI | InChI=1S/C22H34ClN5O3Si/c1-13-15(11-28(29)14(2)18(13)30-6)9-27-10-16(12-31-32(7,8)22(3,4)5)17-19(23)25-21(24)26-20(17)27/h11,16H,9-10,12H2,1-8H3,(H2,24,25,26) |
| InChIKey | ZOWOLXGOJPKUME-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|