C50H46F6N10O2 — CID 87577177
1,2-bis[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-piperidin-4-ylphenyl)hydrazine (PubChem CID 87577177) has the molecular formula C50H46F6N10O2 and a molecular weight of 932.97 g/mol. Its IUPAC name is 1,2-bis[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-piperidin-4-ylphenyl)hydrazine.
| Compound Name | 1,2-bis[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-piperidin-4-ylphenyl)hydrazine |
|---|---|
| PubChem CID | 87577177 |
| Molecular Formula | C50H46F6N10O2 |
| Molecular Weight | 932.97 g/mol |
| Exact Mass | 932.37 |
| IUPAC Name | 1,2-bis[8-[2-methoxy-5-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-piperidin-4-ylphenyl)hydrazine |
| SMILES | COc1ccc(C(F)(F)F)cc1-c1cccn2nc(N(c3cccc(C4CCNCC4)c3)N(c3cccc(C4CCNCC4)c3)c3nc4c(-c5cc(C(F)(F)F)ccc5OC)cccn4n3)nc12 |
| InChI | InChI=1S/C50H46F6N10O2/c1-67-43-15-13-35(49(51,52)53)29-41(43)39-11-5-25-63-45(39)59-47(61-63)65(37-9-3-7-33(27-37)31-17-21-57-22-18-31)66(38-10-4-8-34(28-38)32-19-23-58-24-20-32)48-60-46-40(12-6-26-64(46)62-48)42-30-36(50(54,55)56)14-16-44(42)68-2/h3-16,25-32,57-58H,17-24H2,1-2H3 |
| InChIKey | VHUBAZCHTDONKA-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.97 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|