C48H44F6N12 — CID 87577635
1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]-1,2-bis[8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine (PubChem CID 87577635) has the molecular formula C48H44F6N12 and a molecular weight of 902.95 g/mol. Its IUPAC name is 1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]-1,2-bis[8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine.
| Compound Name | 1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]-1,2-bis[8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine |
|---|---|
| PubChem CID | 87577635 |
| Molecular Formula | C48H44F6N12 |
| Molecular Weight | 902.95 g/mol |
| Exact Mass | 902.37 |
| IUPAC Name | 1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]-1,2-bis[8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]hydrazine |
| SMILES | CN1CCN(c2cccc(N(c3nc4c(-c5ccc(C(F)(F)F)cc5)cccn4n3)N(c3cccc(N4CCN(C)CC4)c3)c3nc4c(-c5ccc(C(F)(F)F)cc5)cccn4n3)c2)CC1 |
| InChI | InChI=1S/C48H44F6N12/c1-59-23-27-61(28-24-59)37-7-3-9-39(31-37)65(45-55-43-41(11-5-21-63(43)57-45)33-13-17-35(18-14-33)47(49,50)51)66(40-10-4-8-38(32-40)62-29-25-60(2)26-30-62)46-56-44-42(12-6-22-64(44)58-46)34-15-19-36(20-16-34)48(52,53)54/h3-22,31-32H,23-30H2,1-2H3 |
| InChIKey | VLKKDOLUHOUSOB-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.95 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|