C23H19BrN4O — CID 87579231
2-bromo-6-[2-(6-methoxy-2-pyridinyl)-2,2-dipyridin-3-ylethyl]pyridine (PubChem CID 87579231) has the molecular formula C23H19BrN4O and a molecular weight of 447.34 g/mol. Its IUPAC name is 2-bromo-6-[2-(6-methoxy-2-pyridinyl)-2,2-dipyridin-3-ylethyl]pyridine.
| Compound Name | 2-bromo-6-[2-(6-methoxy-2-pyridinyl)-2,2-dipyridin-3-ylethyl]pyridine |
|---|---|
| PubChem CID | 87579231 |
| Molecular Formula | C23H19BrN4O |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-bromo-6-[2-(6-methoxy-2-pyridinyl)-2,2-dipyridin-3-ylethyl]pyridine |
| SMILES | COc1cccc(C(Cc2cccc(Br)n2)(c2cccnc2)c2cccnc2)n1 |
| InChI | InChI=1S/C23H19BrN4O/c1-29-22-11-3-9-20(28-22)23(17-6-4-12-25-15-17,18-7-5-13-26-16-18)14-19-8-2-10-21(24)27-19/h2-13,15-16H,14H2,1H3 |
| InChIKey | XBRROIBCIJONMF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|