C22H24N6O4S — CID 87579265
[5-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]-4-methylphenoxy]-2-pyridinyl]carbamothioyl-ethylcarbamic acid (PubChem CID 87579265) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is [5-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]-4-methylphenoxy]-2-pyridinyl]carbamothioyl-ethylcarbamic acid.
| Compound Name | [5-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]-4-methylphenoxy]-2-pyridinyl]carbamothioyl-ethylcarbamic acid |
|---|---|
| PubChem CID | 87579265 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [5-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]-4-methylphenoxy]-2-pyridinyl]carbamothioyl-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)C(=S)Nc1ccc(Oc2ccc(C)c(NC(=O)c3cc(C)nn3C)c2)cn1 |
| InChI | InChI=1S/C22H24N6O4S/c1-5-28(22(30)31)21(33)25-19-9-8-16(12-23-19)32-15-7-6-13(2)17(11-15)24-20(29)18-10-14(3)26-27(18)4/h6-12H,5H2,1-4H3,(H,24,29)(H,30,31)(H,23,25,33) |
| InChIKey | HXXULPDOWWFJGB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|