About pyrrole-2,5-dione;sulfane
pyrrole-2,5-dione;sulfane (PubChem CID 87579772) has the molecular formula C4H5NO2S
and a molecular weight of 131.16 g/mol. Its IUPAC name is pyrrole-2,5-dione;sulfane.
Molecular Properties
| Compound Name | pyrrole-2,5-dione;sulfane |
| PubChem CID | 87579772 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | pyrrole-2,5-dione;sulfane |
| SMILES | O=C1C=CC(=O)N1.S |
| InChI | InChI=1S/C4H3NO2.H2S/c6-3-1-2-4(7)5-3;/h1-2H,(H,5,6,7);1H2 |
| InChIKey | OYDDGBUEQORYIJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrole-2,5-dione;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-2,5-dione;sulfane?
The IUPAC name of pyrrole-2,5-dione;sulfane (CID 87579772) is pyrrole-2,5-dione;sulfane.
What is the SMILES notation for pyrrole-2,5-dione;sulfane?
The canonical SMILES for pyrrole-2,5-dione;sulfane is O=C1C=CC(=O)N1.S.
What is the InChIKey of pyrrole-2,5-dione;sulfane?
The InChIKey is OYDDGBUEQORYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.H2S/c6-3-1-2-4(7)5-3;/h1-2H,(H,5,6,7);1H2.
What are the key properties of pyrrole-2,5-dione;sulfane?
pyrrole-2,5-dione;sulfane has a molecular weight of 131.16 g/mol, XLogP of -0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-2,5-dione;sulfane is sourced from PubChem (CID 87579772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).